C37H31O3P — CID 23268057
(4S,5R)-5-[ethoxy(phenyl)phosphoryl]-2,3,4,5-tetraphenylcyclopent-2-en-1-one (PubChem CID 23268057) has the molecular formula C37H31O3P and a molecular weight of 554.63 g/mol. Its IUPAC name is (4S,5R)-5-[ethoxy(phenyl)phosphoryl]-2,3,4,5-tetraphenylcyclopent-2-en-1-one.
| Compound Name | (4S,5R)-5-[ethoxy(phenyl)phosphoryl]-2,3,4,5-tetraphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 23268057 |
| Molecular Formula | C37H31O3P |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | (4S,5R)-5-[ethoxy(phenyl)phosphoryl]-2,3,4,5-tetraphenylcyclopent-2-en-1-one |
| SMILES | CCOP(=O)(c1ccccc1)[C@]1(c2ccccc2)C(=O)C(c2ccccc2)=C(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C37H31O3P/c1-2-40-41(39,32-26-16-7-17-27-32)37(31-24-14-6-15-25-31)35(30-22-12-5-13-23-30)33(28-18-8-3-9-19-28)34(36(37)38)29-20-10-4-11-21-29/h3-27,35H,2H2,1H3/t35-,37-,41?/m0/s1 |
| InChIKey | XLUIYPQBESSPHT-YBBWZUSWSA-N |
| XLogP | 8.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|