C11H22N2O — CID 23269671
5-ethoxy-1-N,1-N,2-N,2-N-tetramethylpent-3-yne-1,2-diamine (PubChem CID 23269671) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 5-ethoxy-1-N,1-N,2-N,2-N-tetramethylpent-3-yne-1,2-diamine.
| Compound Name | 5-ethoxy-1-N,1-N,2-N,2-N-tetramethylpent-3-yne-1,2-diamine |
|---|---|
| PubChem CID | 23269671 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 5-ethoxy-1-N,1-N,2-N,2-N-tetramethylpent-3-yne-1,2-diamine |
| SMILES | CCOCC#CC(CN(C)C)N(C)C |
| InChI | InChI=1S/C11H22N2O/c1-6-14-9-7-8-11(13(4)5)10-12(2)3/h11H,6,9-10H2,1-5H3 |
| InChIKey | SQSDKMAHHOKSBN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|