C8H16N2 — CID 23269104
1-N,1-N,2-N,2-N-tetramethylbut-3-yne-1,2-diamine (PubChem CID 23269104) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetramethylbut-3-yne-1,2-diamine.
| Compound Name | 1-N,1-N,2-N,2-N-tetramethylbut-3-yne-1,2-diamine |
|---|---|
| PubChem CID | 23269104 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetramethylbut-3-yne-1,2-diamine |
| SMILES | C#CC(CN(C)C)N(C)C |
| InChI | InChI=1S/C8H16N2/c1-6-8(10(4)5)7-9(2)3/h1,8H,7H2,2-5H3 |
| InChIKey | WOWHNEIJUZXCHN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|