C7H18N2S — CID 13474082
1,3-bis(dimethylamino)propane-2-thiol (PubChem CID 13474082) has the molecular formula C7H18N2S and a molecular weight of 162.30 g/mol. Its IUPAC name is 1,3-bis(dimethylamino)propane-2-thiol.
| Compound Name | 1,3-bis(dimethylamino)propane-2-thiol |
|---|---|
| PubChem CID | 13474082 |
| Molecular Formula | C7H18N2S |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,3-bis(dimethylamino)propane-2-thiol |
| SMILES | CN(C)CC(S)CN(C)C |
| InChI | InChI=1S/C7H18N2S/c1-8(2)5-7(10)6-9(3)4/h7,10H,5-6H2,1-4H3 |
| InChIKey | LWOVXABTPFAHBJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|