C5H14N2OS — CID 155704419
N',N'-dimethyl-2-sulfanyloxypropane-1,3-diamine (PubChem CID 155704419) has the molecular formula C5H14N2OS and a molecular weight of 150.25 g/mol. Its IUPAC name is N',N'-dimethyl-2-sulfanyloxypropane-1,3-diamine.
| Compound Name | N',N'-dimethyl-2-sulfanyloxypropane-1,3-diamine |
|---|---|
| PubChem CID | 155704419 |
| Molecular Formula | C5H14N2OS |
| Molecular Weight | 150.25 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | N',N'-dimethyl-2-sulfanyloxypropane-1,3-diamine |
| SMILES | CN(C)CC(CN)OS |
| InChI | InChI=1S/C5H14N2OS/c1-7(2)4-5(3-6)8-9/h5,9H,3-4,6H2,1-2H3 |
| InChIKey | PBFWCVAMOMYOBI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.25 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|