C10H20N2 — CID 156812983
2-ethyl-N'-ethynyl-N,N-dimethylbutane-1,4-diamine (PubChem CID 156812983) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-ethyl-N'-ethynyl-N,N-dimethylbutane-1,4-diamine.
| Compound Name | 2-ethyl-N'-ethynyl-N,N-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 156812983 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-ethyl-N'-ethynyl-N,N-dimethylbutane-1,4-diamine |
| SMILES | C#CNCCC(CC)CN(C)C |
| InChI | InChI=1S/C10H20N2/c1-5-10(9-12(3)4)7-8-11-6-2/h2,10-11H,5,7-9H2,1,3-4H3 |
| InChIKey | WQJLFCJFWMLDNN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|