C7H16ClN — CID 55303593
2-(chloromethyl)-N,N-dimethylbutan-1-amine (PubChem CID 55303593) has the molecular formula C7H16ClN and a molecular weight of 149.67 g/mol. Its IUPAC name is 2-(chloromethyl)-N,N-dimethylbutan-1-amine.
| Compound Name | 2-(chloromethyl)-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 55303593 |
| Molecular Formula | C7H16ClN |
| Molecular Weight | 149.67 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2-(chloromethyl)-N,N-dimethylbutan-1-amine |
| SMILES | CCC(CCl)CN(C)C |
| InChI | InChI=1S/C7H16ClN/c1-4-7(5-8)6-9(2)3/h7H,4-6H2,1-3H3 |
| InChIKey | SLONSEVGLIREAA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.67 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|