C10H25N3 — CID 151532643
1-N,1-N,2-N,2-N,4-N,4-N-hexamethylbutane-1,2,4-triamine (PubChem CID 151532643) has the molecular formula C10H25N3 and a molecular weight of 187.33 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N,4-N,4-N-hexamethylbutane-1,2,4-triamine.
| Compound Name | 1-N,1-N,2-N,2-N,4-N,4-N-hexamethylbutane-1,2,4-triamine |
|---|---|
| PubChem CID | 151532643 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | 1-N,1-N,2-N,2-N,4-N,4-N-hexamethylbutane-1,2,4-triamine |
| SMILES | CN(C)CCC(CN(C)C)N(C)C |
| InChI | InChI=1S/C10H25N3/c1-11(2)8-7-10(13(5)6)9-12(3)4/h10H,7-9H2,1-6H3 |
| InChIKey | PWULLXNTUAZIMD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |