C15H32N2O — CID 135235410
(2R)-N,N,N',N'-tetramethyl-2-[(3S)-3-(3-methylbutan-2-yl)oxiran-2-yl]butane-1,4-diamine (PubChem CID 135235410) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is (2R)-N,N,N',N'-tetramethyl-2-[(3S)-3-(3-methylbutan-2-yl)oxiran-2-yl]butane-1,4-diamine.
| Compound Name | (2R)-N,N,N',N'-tetramethyl-2-[(3S)-3-(3-methylbutan-2-yl)oxiran-2-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 135235410 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | (2R)-N,N,N',N'-tetramethyl-2-[(3S)-3-(3-methylbutan-2-yl)oxiran-2-yl]butane-1,4-diamine |
| SMILES | CC(C)C(C)[C@@H]1OC1[C@H](CCN(C)C)CN(C)C |
| InChI | InChI=1S/C15H32N2O/c1-11(2)12(3)14-15(18-14)13(10-17(6)7)8-9-16(4)5/h11-15H,8-10H2,1-7H3/t12?,13-,14+,15?/m1/s1 |
| InChIKey | HCUSJZGGCDVNDH-FUUBYGMNSA-N |
| XLogP | 2.18 |
| TPSA | 19.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|