C6H12N2 — CID 79095341
1-N,1-N-dimethylbut-3-yne-1,2-diamine (PubChem CID 79095341) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 1-N,1-N-dimethylbut-3-yne-1,2-diamine.
| Compound Name | 1-N,1-N-dimethylbut-3-yne-1,2-diamine |
|---|---|
| PubChem CID | 79095341 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1-N,1-N-dimethylbut-3-yne-1,2-diamine |
| SMILES | C#CC(N)CN(C)C |
| InChI | InChI=1S/C6H12N2/c1-4-6(7)5-8(2)3/h1,6H,5,7H2,2-3H3 |
| InChIKey | WIZUAYCPFRCAMD-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|