C5H10N2 — CID 173144739
1-N'-ethynyl-1-N'-methylethane-1,1-diamine (PubChem CID 173144739) has the molecular formula C5H10N2 and a molecular weight of 98.15 g/mol. Its IUPAC name is 1-N'-ethynyl-1-N'-methylethane-1,1-diamine.
| Compound Name | 1-N'-ethynyl-1-N'-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 173144739 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 1-N'-ethynyl-1-N'-methylethane-1,1-diamine |
| SMILES | C#CN(C)C(C)N |
| InChI | InChI=1S/C5H10N2/c1-4-7(3)5(2)6/h1,5H,6H2,2-3H3 |
| InChIKey | APLDVULOXBBGIL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|