C5H11N2- — CID 5249356
1-N'-ethenyl-1-N'-methylethane-1,1-diamine (PubChem CID 5249356) has the molecular formula C5H11N2- and a molecular weight of 99.16 g/mol. Its IUPAC name is 1-N'-ethenyl-1-N'-methylethane-1,1-diamine.
| Compound Name | 1-N'-ethenyl-1-N'-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 5249356 |
| Molecular Formula | C5H11N2- |
| Molecular Weight | 99.16 g/mol |
| Exact Mass | 99.09 |
| IUPAC Name | 1-N'-ethenyl-1-N'-methylethane-1,1-diamine |
| SMILES | C=[C-]N(C)C(C)N |
| InChI | InChI=1S/C5H11N2/c1-4-7(3)5(2)6/h5H,1,6H2,2-3H3/q-1 |
| InChIKey | JIZWIBRYTUMIDI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.16 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|