About N,N-dimethylmethanamine;ethynylsilane
N,N-dimethylmethanamine;ethynylsilane (PubChem CID 172684114) has the molecular formula C5H13NSi
and a molecular weight of 115.25 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethynylsilane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;ethynylsilane |
| PubChem CID | 172684114 |
| Molecular Formula | C5H13NSi |
| Molecular Weight | 115.25 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | N,N-dimethylmethanamine;ethynylsilane |
| SMILES | C#C[SiH3].CN(C)C |
| InChI | InChI=1S/C3H9N.C2H4Si/c1-4(2)3;1-2-3/h1-3H3;1H,3H3 |
| InChIKey | AUNCXQIEYCSPPB-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;ethynylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;ethynylsilane?
The IUPAC name of N,N-dimethylmethanamine;ethynylsilane (CID 172684114) is N,N-dimethylmethanamine;ethynylsilane.
What is the SMILES notation for N,N-dimethylmethanamine;ethynylsilane?
The canonical SMILES for N,N-dimethylmethanamine;ethynylsilane is C#C[SiH3].CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;ethynylsilane?
The InChIKey is AUNCXQIEYCSPPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H4Si/c1-4(2)3;1-2-3/h1-3H3;1H,3H3.
What are the key properties of N,N-dimethylmethanamine;ethynylsilane?
N,N-dimethylmethanamine;ethynylsilane has a molecular weight of 115.25 g/mol, XLogP of -0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;ethynylsilane is sourced from PubChem (CID 172684114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).