About N,N-dimethylmethanamine;hydroxysilane;zinc
N,N-dimethylmethanamine;hydroxysilane;zinc (PubChem CID 174382751) has the molecular formula C3H13NOSiZn
and a molecular weight of 172.62 g/mol. Its IUPAC name is N,N-dimethylmethanamine;hydroxysilane;zinc.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;hydroxysilane;zinc |
| PubChem CID | 174382751 |
| Molecular Formula | C3H13NOSiZn |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | N,N-dimethylmethanamine;hydroxysilane;zinc |
| SMILES | CN(C)C.O[SiH3].[Zn] |
| InChI | InChI=1S/C3H9N.H4OSi.Zn/c1-4(2)3;1-2;/h1-3H3;1H,2H3; |
| InChIKey | IXNOVTYKBGEBKS-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;hydroxysilane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;hydroxysilane;zinc?
The IUPAC name of N,N-dimethylmethanamine;hydroxysilane;zinc (CID 174382751) is N,N-dimethylmethanamine;hydroxysilane;zinc.
What is the SMILES notation for N,N-dimethylmethanamine;hydroxysilane;zinc?
The canonical SMILES for N,N-dimethylmethanamine;hydroxysilane;zinc is CN(C)C.O[SiH3].[Zn].
What is the InChIKey of N,N-dimethylmethanamine;hydroxysilane;zinc?
The InChIKey is IXNOVTYKBGEBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.H4OSi.Zn/c1-4(2)3;1-2;/h1-3H3;1H,2H3;.
What are the key properties of N,N-dimethylmethanamine;hydroxysilane;zinc?
N,N-dimethylmethanamine;hydroxysilane;zinc has a molecular weight of 172.62 g/mol, XLogP of -1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;hydroxysilane;zinc is sourced from PubChem (CID 174382751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).