C17H15NO9S3 — CID 23270
4-amino-5-(4-methylphenyl)sulfonyloxynaphthalene-2,7-disulfonic acid (PubChem CID 23270) has the molecular formula C17H15NO9S3 and a molecular weight of 473.51 g/mol. Its IUPAC name is 4-amino-5-(4-methylphenyl)sulfonyloxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-5-(4-methylphenyl)sulfonyloxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 23270 |
| Molecular Formula | C17H15NO9S3 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | 4-amino-5-(4-methylphenyl)sulfonyloxynaphthalene-2,7-disulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(N)c23)cc1 |
| InChI | InChI=1S/C17H15NO9S3/c1-10-2-4-12(5-3-10)30(25,26)27-16-9-14(29(22,23)24)7-11-6-13(28(19,20)21)8-15(18)17(11)16/h2-9H,18H2,1H3,(H,19,20,21)(H,22,23,24) |
| InChIKey | ZIQWUYNDHGXLIN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 178.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|