C10H9NO7S2 — CID 7009
4-amino-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 7009) has the molecular formula C10H9NO7S2 and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 7009 |
| Molecular Formula | C10H9NO7S2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C10H9NO7S2/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18) |
| InChIKey | APRRQJCCBSJQOQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|