C10H8NNaO7S2 — CID 23691040
sodium 5-amino-4-hydroxy-7-sulfonaphthalene-2-sulfonate (PubChem CID 23691040) has the molecular formula C10H8NNaO7S2 and a molecular weight of 341.30 g/mol. Its IUPAC name is sodium 5-amino-4-hydroxy-7-sulfonaphthalene-2-sulfonate.
| Compound Name | sodium 5-amino-4-hydroxy-7-sulfonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 23691040 |
| Molecular Formula | C10H8NNaO7S2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | sodium 5-amino-4-hydroxy-7-sulfonaphthalene-2-sulfonate |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)[O-])cc(O)c12.[Na+] |
| InChI | InChI=1S/C10H9NO7S2.Na/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8;/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18);/q;+1/p-1 |
| InChIKey | QPILZZVXGUNELN-UHFFFAOYSA-M |
| XLogP | -2.72 |
| TPSA | 157.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|