C6H12O2 — CID 23270698
1,2,2,6,6-pentadeuteriocyclohexane-1,4-diol (PubChem CID 23270698) has the molecular formula C6H12O2 and a molecular weight of 121.19 g/mol. Its IUPAC name is 1,2,2,6,6-pentadeuteriocyclohexane-1,4-diol.
| Compound Name | 1,2,2,6,6-pentadeuteriocyclohexane-1,4-diol |
|---|---|
| PubChem CID | 23270698 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 121.19 g/mol |
| Exact Mass | 121.12 |
| IUPAC Name | 1,2,2,6,6-pentadeuteriocyclohexane-1,4-diol |
| SMILES | [2H]C1([2H])CC(O)CC([2H])([2H])C1([2H])O |
| InChI | InChI=1S/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/i1D2,3D2,5D |
| InChIKey | VKONPUDBRVKQLM-YTRXXWTKSA-N |
| XLogP | 0.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |