C4H8O — CID 23270591
1,2,2,4,4-pentadeuteriocyclobutan-1-ol (PubChem CID 23270591) has the molecular formula C4H8O and a molecular weight of 77.14 g/mol. Its IUPAC name is 1,2,2,4,4-pentadeuteriocyclobutan-1-ol.
| Compound Name | 1,2,2,4,4-pentadeuteriocyclobutan-1-ol |
|---|---|
| PubChem CID | 23270591 |
| Molecular Formula | C4H8O |
| Molecular Weight | 77.14 g/mol |
| Exact Mass | 77.09 |
| IUPAC Name | 1,2,2,4,4-pentadeuteriocyclobutan-1-ol |
| SMILES | [2H]C1([2H])CC([2H])([2H])C1([2H])O |
| InChI | InChI=1S/C4H8O/c5-4-2-1-3-4/h4-5H,1-3H2/i2D2,3D2,4D |
| InChIKey | KTHXBEHDVMTNOH-OOCCYNIISA-N |
| XLogP | 0.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 77.14 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |