C5H12ClNO — CID 171394746
2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol;hydrochloride (PubChem CID 171394746) has the molecular formula C5H12ClNO and a molecular weight of 146.66 g/mol. Its IUPAC name is 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol;hydrochloride.
| Compound Name | 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 171394746 |
| Molecular Formula | C5H12ClNO |
| Molecular Weight | 146.66 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidin-4-ol;hydrochloride |
| SMILES | Cl.[2H]C1([2H])NC([2H])([2H])C([2H])([2H])C([2H])(O)C1([2H])[2H] |
| InChI | InChI=1S/C5H11NO.ClH/c7-5-1-3-6-4-2-5;/h5-7H,1-4H2;1H/i1D2,2D2,3D2,4D2,5D; |
| InChIKey | VKCORPXOKYDINR-PGXDZSOZSA-N |
| XLogP | 0.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.66 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |