C10H20N4 — CID 171049260
bis(1,2,2,3,3,4,5,5-octadeuteriopiperidin-4-yl)diazene (PubChem CID 171049260) has the molecular formula C10H20N4 and a molecular weight of 212.40 g/mol. Its IUPAC name is bis(1,2,2,3,3,4,5,5-octadeuteriopiperidin-4-yl)diazene.
| Compound Name | bis(1,2,2,3,3,4,5,5-octadeuteriopiperidin-4-yl)diazene |
|---|---|
| PubChem CID | 171049260 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 212.40 g/mol |
| Exact Mass | 212.27 |
| IUPAC Name | bis(1,2,2,3,3,4,5,5-octadeuteriopiperidin-4-yl)diazene |
| SMILES | [2H]N1CC([2H])([2H])C([2H])(/N=N/C2([2H])C([2H])([2H])CN([2H])C([2H])([2H])C2([2H])[2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C10H20N4/c1-5-11-6-2-9(1)13-14-10-3-7-12-8-4-10/h9-12H,1-8H2/b14-13+/i1D2,2D2,3D2,4D2,5D2,7D2,9D,10D/hD2 |
| InChIKey | LPJAZSOFEHITCZ-PCLQUYLZSA-N |
| XLogP | 0.94 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|