C6H12N2O — CID 131869337
2,2,3,3,4,5,5,6,6-nonadeuteriopiperidine-4-carboxamide (PubChem CID 131869337) has the molecular formula C6H12N2O and a molecular weight of 137.23 g/mol. Its IUPAC name is 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidine-4-carboxamide.
| Compound Name | 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 131869337 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.15 |
| IUPAC Name | 2,2,3,3,4,5,5,6,6-nonadeuteriopiperidine-4-carboxamide |
| SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])C([2H])(C(N)=O)C1([2H])[2H] |
| InChI | InChI=1S/C6H12N2O/c7-6(9)5-1-3-8-4-2-5/h5,8H,1-4H2,(H2,7,9)/i1D2,2D2,3D2,4D2,5D |
| InChIKey | DPBWFNDFMCCGGJ-UHUJFCCWSA-N |
| XLogP | -0.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |