C5H10N2O — CID 154789990
(2S)-2,5,5-trideuteriopyrrolidine-2-carboxamide (PubChem CID 154789990) has the molecular formula C5H10N2O and a molecular weight of 117.17 g/mol. Its IUPAC name is (2S)-2,5,5-trideuteriopyrrolidine-2-carboxamide.
| Compound Name | (2S)-2,5,5-trideuteriopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154789990 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | (2S)-2,5,5-trideuteriopyrrolidine-2-carboxamide |
| SMILES | [2H]C1([2H])CC[C@@]([2H])(C(N)=O)N1 |
| InChI | InChI=1S/C5H10N2O/c6-5(8)4-2-1-3-7-4/h4,7H,1-3H2,(H2,6,8)/t4-/m0/s1/i3D2,4D |
| InChIKey | VLJNHYLEOZPXFW-KIZNEYSQSA-N |
| XLogP | -0.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |