C5H9NO2 — CID 101007276
(2S,5S)-5-deuteriopyrrolidine-2-carboxylic acid (PubChem CID 101007276) has the molecular formula C5H9NO2 and a molecular weight of 116.14 g/mol. Its IUPAC name is (2S,5S)-5-deuteriopyrrolidine-2-carboxylic acid.
| Compound Name | (2S,5S)-5-deuteriopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 101007276 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 116.14 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | (2S,5S)-5-deuteriopyrrolidine-2-carboxylic acid |
| SMILES | [2H][C@H]1CC[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1/i3D/t3-,4- |
| InChIKey | ONIBWKKTOPOVIA-CSXTTWPYSA-N |
| XLogP | -0.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.14 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |