C30H24O — CID 23270729
phenyl-[(1S,4S,5S)-2,4,5-triphenylcyclopent-2-en-1-yl]methanone (PubChem CID 23270729) has the molecular formula C30H24O and a molecular weight of 400.52 g/mol. Its IUPAC name is phenyl-[(1S,4S,5S)-2,4,5-triphenylcyclopent-2-en-1-yl]methanone.
| Compound Name | phenyl-[(1S,4S,5S)-2,4,5-triphenylcyclopent-2-en-1-yl]methanone |
|---|---|
| PubChem CID | 23270729 |
| Molecular Formula | C30H24O |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | phenyl-[(1S,4S,5S)-2,4,5-triphenylcyclopent-2-en-1-yl]methanone |
| SMILES | O=C(c1ccccc1)[C@@H]1C(c2ccccc2)=C[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H24O/c31-30(25-19-11-4-12-20-25)29-27(23-15-7-2-8-16-23)21-26(22-13-5-1-6-14-22)28(29)24-17-9-3-10-18-24/h1-21,26,28-29H/t26-,28+,29-/m1/s1 |
| InChIKey | GYVYYONIWHTFSF-XNFLFYSQSA-N |
| XLogP | 7.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |