C16H22N2O — CID 2327108
(1R)-1-[4,5-bis(dimethylamino)naphthalen-1-yl]ethanol (PubChem CID 2327108) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (1R)-1-[4,5-bis(dimethylamino)naphthalen-1-yl]ethanol.
| Compound Name | (1R)-1-[4,5-bis(dimethylamino)naphthalen-1-yl]ethanol |
|---|---|
| PubChem CID | 2327108 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (1R)-1-[4,5-bis(dimethylamino)naphthalen-1-yl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N(C)C)c2c(N(C)C)cccc12 |
| InChI | InChI=1S/C16H22N2O/c1-11(19)12-9-10-15(18(4)5)16-13(12)7-6-8-14(16)17(2)3/h6-11,19H,1-5H3/t11-/m1/s1 |
| InChIKey | FQSQSJQXIWCCID-LLVKDONJSA-N |
| XLogP | 3.03 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|