C29H36N4O — CID 15890498
bis[4,5-bis(dimethylamino)naphthalen-1-yl]methanol (PubChem CID 15890498) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is bis[4,5-bis(dimethylamino)naphthalen-1-yl]methanol.
| Compound Name | bis[4,5-bis(dimethylamino)naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 15890498 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | bis[4,5-bis(dimethylamino)naphthalen-1-yl]methanol |
| SMILES | CN(C)c1cccc2c(C(O)c3ccc(N(C)C)c4c(N(C)C)cccc34)ccc(N(C)C)c12 |
| InChI | InChI=1S/C29H36N4O/c1-30(2)23-13-9-11-19-21(15-17-25(27(19)23)32(5)6)29(34)22-16-18-26(33(7)8)28-20(22)12-10-14-24(28)31(3)4/h9-18,29,34H,1-8H3 |
| InChIKey | VXDDTBKMTWWTNP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|