C13H14IN — CID 135022993
4-iodo-N,N,8-trimethylnaphthalen-1-amine (PubChem CID 135022993) has the molecular formula C13H14IN and a molecular weight of 311.17 g/mol. Its IUPAC name is 4-iodo-N,N,8-trimethylnaphthalen-1-amine.
| Compound Name | 4-iodo-N,N,8-trimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 135022993 |
| Molecular Formula | C13H14IN |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 4-iodo-N,N,8-trimethylnaphthalen-1-amine |
| SMILES | Cc1cccc2c(I)ccc(N(C)C)c12 |
| InChI | InChI=1S/C13H14IN/c1-9-5-4-6-10-11(14)7-8-12(13(9)10)15(2)3/h4-8H,1-3H3 |
| InChIKey | FRUFGIJWMBIEMD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|