C25H33NO2Si — CID 11101598
[5-[tert-butyl(dimethyl)silyl]oxy-8-(dimethylamino)naphthalen-1-yl]-phenylmethanol (PubChem CID 11101598) has the molecular formula C25H33NO2Si and a molecular weight of 407.63 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-8-(dimethylamino)naphthalen-1-yl]-phenylmethanol.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-8-(dimethylamino)naphthalen-1-yl]-phenylmethanol |
|---|---|
| PubChem CID | 11101598 |
| Molecular Formula | C25H33NO2Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-8-(dimethylamino)naphthalen-1-yl]-phenylmethanol |
| SMILES | CN(C)c1ccc(O[Si](C)(C)C(C)(C)C)c2cccc(C(O)c3ccccc3)c12 |
| InChI | InChI=1S/C25H33NO2Si/c1-25(2,3)29(6,7)28-22-17-16-21(26(4)5)23-19(22)14-11-15-20(23)24(27)18-12-9-8-10-13-18/h8-17,24,27H,1-7H3 |
| InChIKey | ZMTUKWHWZAPZCE-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|