C15H19NO4 — CID 23271713
ethyl (E)-3-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)prop-2-enoate (PubChem CID 23271713) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is ethyl (E)-3-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 23271713 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | ethyl (E)-3-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnc(C)c2c1COC(C)(C)O2 |
| InChI | InChI=1S/C15H19NO4/c1-5-18-13(17)7-6-11-8-16-10(2)14-12(11)9-19-15(3,4)20-14/h6-8H,5,9H2,1-4H3/b7-6+ |
| InChIKey | AIINYZDQUPGXQA-VOTSOKGWSA-N |
| XLogP | 2.61 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|