C12H18NO5P — CID 142082166
1-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethylphosphonic acid (PubChem CID 142082166) has the molecular formula C12H18NO5P and a molecular weight of 287.25 g/mol. Its IUPAC name is 1-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethylphosphonic acid.
| Compound Name | 1-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethylphosphonic acid |
|---|---|
| PubChem CID | 142082166 |
| Molecular Formula | C12H18NO5P |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethylphosphonic acid |
| SMILES | Cc1ncc(C(C)P(=O)(O)O)c2c1OC(C)(C)OC2 |
| InChI | InChI=1S/C12H18NO5P/c1-7-11-10(6-17-12(3,4)18-11)9(5-13-7)8(2)19(14,15)16/h5,8H,6H2,1-4H3,(H2,14,15,16) |
| InChIKey | KIEHVXKJYMJDFG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|