C24H32O8 — CID 23272035
dimethyl (3aR,4R,9R,9aS)-5,9-dimethyl-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2-oxo-4,4a,6,7,8,8a,9,9a-octahydro-3aH-benzo[f][1]benzofuran-5,8-dicarboxylate (PubChem CID 23272035) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is dimethyl (3aR,4R,9R,9aS)-5,9-dimethyl-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2-oxo-4,4a,6,7,8,8a,9,9a-octahydro-3aH-benzo[f][1]benzofuran-5,8-dicarboxylate.
| Compound Name | dimethyl (3aR,4R,9R,9aS)-5,9-dimethyl-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2-oxo-4,4a,6,7,8,8a,9,9a-octahydro-3aH-benzo[f][1]benzofuran-5,8-dicarboxylate |
|---|---|
| PubChem CID | 23272035 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | dimethyl (3aR,4R,9R,9aS)-5,9-dimethyl-4-[(E)-2-methylbut-2-enoyl]oxy-3-methylidene-2-oxo-4,4a,6,7,8,8a,9,9a-octahydro-3aH-benzo[f][1]benzofuran-5,8-dicarboxylate |
| SMILES | C=C1C(=O)O[C@H]2C(C)C3C(C(=O)OC)CCC(C)(C(=O)OC)C3C(OC(=O)/C(C)=C/C)[C@H]12 |
| InChI | InChI=1S/C24H32O8/c1-8-11(2)20(25)32-19-16-13(4)21(26)31-18(16)12(3)15-14(22(27)29-6)9-10-24(5,17(15)19)23(28)30-7/h8,12,14-19H,4,9-10H2,1-3,5-7H3/b11-8+/t12?,14?,15?,16-,17?,18+,19?,24?/m1/s1 |
| InChIKey | DTQPSEXAGXVIQA-CNKCKAHWSA-N |
| XLogP | 2.61 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|