C10H16N2O4 — CID 23272978
methyl N-[(Z)-(2,2,5,5-tetramethyl-4-oxooxolan-3-ylidene)amino]carbamate (PubChem CID 23272978) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is methyl N-[(Z)-(2,2,5,5-tetramethyl-4-oxooxolan-3-ylidene)amino]carbamate.
| Compound Name | methyl N-[(Z)-(2,2,5,5-tetramethyl-4-oxooxolan-3-ylidene)amino]carbamate |
|---|---|
| PubChem CID | 23272978 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | methyl N-[(Z)-(2,2,5,5-tetramethyl-4-oxooxolan-3-ylidene)amino]carbamate |
| SMILES | COC(=O)N/N=C1\C(=O)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C10H16N2O4/c1-9(2)6(11-12-8(14)15-5)7(13)10(3,4)16-9/h1-5H3,(H,12,14)/b11-6+ |
| InChIKey | XDXUUEFFUHDBQY-IZZDOVSWSA-N |
| XLogP | 0.85 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|