C10H16N2O6 — CID 10563269
ethyl 4-(methoxycarbonylamino)-5,5-dimethyl-2-oxo-1,3-oxazolidine-4-carboxylate (PubChem CID 10563269) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is ethyl 4-(methoxycarbonylamino)-5,5-dimethyl-2-oxo-1,3-oxazolidine-4-carboxylate.
| Compound Name | ethyl 4-(methoxycarbonylamino)-5,5-dimethyl-2-oxo-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10563269 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | ethyl 4-(methoxycarbonylamino)-5,5-dimethyl-2-oxo-1,3-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)OC)NC(=O)OC1(C)C |
| InChI | InChI=1S/C10H16N2O6/c1-5-17-6(13)10(11-7(14)16-4)9(2,3)18-8(15)12-10/h5H2,1-4H3,(H,11,14)(H,12,15) |
| InChIKey | AEMDWCAMOQFYPJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|