C15H18ClNO4 — CID 42625435
ethyl 6-chloro-2,5,7,8-tetramethyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate (PubChem CID 42625435) has the molecular formula C15H18ClNO4 and a molecular weight of 311.77 g/mol. Its IUPAC name is ethyl 6-chloro-2,5,7,8-tetramethyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate.
| Compound Name | ethyl 6-chloro-2,5,7,8-tetramethyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 42625435 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | ethyl 6-chloro-2,5,7,8-tetramethyl-3-oxo-4H-1,4-benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)C1(C)Oc2c(C)c(C)c(Cl)c(C)c2NC1=O |
| InChI | InChI=1S/C15H18ClNO4/c1-6-20-14(19)15(5)13(18)17-11-9(4)10(16)7(2)8(3)12(11)21-15/h6H2,1-5H3,(H,17,18) |
| InChIKey | JDEWFQPVEZDYMW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|