C12H14N2O2S — CID 23274604
3-cyclopentyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 23274604) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-cyclopentyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-cyclopentyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 23274604 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3-cyclopentyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | O=S1(=O)N=C(C2CCCC2)Nc2ccccc21 |
| InChI | InChI=1S/C12H14N2O2S/c15-17(16)11-8-4-3-7-10(11)13-12(14-17)9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2,(H,13,14) |
| InChIKey | DWDZPJCCEADYFT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |