C13H9FN2O2S — CID 4132406
3-(4-fluorophenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 4132406) has the molecular formula C13H9FN2O2S and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-(4-fluorophenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 4132406 |
| Molecular Formula | C13H9FN2O2S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-(4-fluorophenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | O=S1(=O)N=C(c2ccc(F)cc2)Nc2ccccc21 |
| InChI | InChI=1S/C13H9FN2O2S/c14-10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)19(17,18)16-13/h1-8H,(H,15,16) |
| InChIKey | HYMDNWRFJGMADE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |