C17H37N2OS3Tc — CID 23276515
8-(diethylamino)octane-1-thiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) (PubChem CID 23276515) has the molecular formula C17H37N2OS3Tc and a molecular weight of 479.70 g/mol. Its IUPAC name is 8-(diethylamino)octane-1-thiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+).
| Compound Name | 8-(diethylamino)octane-1-thiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) |
|---|---|
| PubChem CID | 23276515 |
| Molecular Formula | C17H37N2OS3Tc |
| Molecular Weight | 479.70 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 8-(diethylamino)octane-1-thiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) |
| SMILES | CCN(CC)CCCCCCCC[S-].CN(CC[S-])CC[S-].O=[Tc+3] |
| InChI | InChI=1S/C12H27NS.C5H13NS2.O.Tc/c1-3-13(4-2)11-9-7-5-6-8-10-12-14;1-6(2-4-7)3-5-8;;/h14H,3-12H2,1-2H3;7-8H,2-5H2,1H3;;/q;;;+3/p-3 |
| InChIKey | UOSMSSHBGDIZEV-UHFFFAOYSA-K |
| XLogP | 3.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|