About 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+)
2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) (PubChem CID 10813519) has the molecular formula C15H33N2OS3Tc
and a molecular weight of 451.64 g/mol. Its IUPAC name is 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+).
Molecular Properties
| Compound Name | 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) |
| PubChem CID | 10813519 |
| Molecular Formula | C15H33N2OS3Tc |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) |
| SMILES | CCCCN(CC[S-])CCCC.CN(CC[S-])CC[S-].O=[Tc+3] |
| InChI | InChI=1S/C10H23NS.C5H13NS2.O.Tc/c1-3-5-7-11(9-10-12)8-6-4-2;1-6(2-4-7)3-5-8;;/h12H,3-10H2,1-2H3;7-8H,2-5H2,1H3;;/q;;;+3/p-3 |
| InChIKey | CMWQIADOVAIOLF-UHFFFAOYSA-K |
| XLogP | 2.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+)?
The IUPAC name of 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) (CID 10813519) is 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+).
What is the SMILES notation for 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+)?
The canonical SMILES for 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) is CCCCN(CC[S-])CCCC.CN(CC[S-])CC[S-].O=[Tc+3].
What is the InChIKey of 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+)?
The InChIKey is CMWQIADOVAIOLF-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H23NS.C5H13NS2.O.Tc/c1-3-5-7-11(9-10-12)8-6-4-2;1-6(2-4-7)3-5-8;;/h12H,3-10H2,1-2H3;7-8H,2-5H2,1H3;;/q;;;+3/p-3.
What are the key properties of 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+)?
2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) has a molecular weight of 451.64 g/mol, XLogP of 2.33, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibutylamino)ethanethiolate;2-[methyl(2-sulfidoethyl)amino]ethanethiolate;oxotechnetium(3+) is sourced from PubChem (CID 10813519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).