C20H18FN3O3S — CID 23286014
5-benzoyl-1-[2-fluoro-4-(sulfamoylamino)phenyl]-2,3-dihydro-1H-pyrrolizine (PubChem CID 23286014) has the molecular formula C20H18FN3O3S and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-benzoyl-1-[2-fluoro-4-(sulfamoylamino)phenyl]-2,3-dihydro-1H-pyrrolizine.
| Compound Name | 5-benzoyl-1-[2-fluoro-4-(sulfamoylamino)phenyl]-2,3-dihydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 23286014 |
| Molecular Formula | C20H18FN3O3S |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 5-benzoyl-1-[2-fluoro-4-(sulfamoylamino)phenyl]-2,3-dihydro-1H-pyrrolizine |
| SMILES | NS(=O)(=O)Nc1ccc(C2CCn3c(C(=O)c4ccccc4)ccc32)c(F)c1 |
| InChI | InChI=1S/C20H18FN3O3S/c21-17-12-14(23-28(22,26)27)6-7-15(17)16-10-11-24-18(16)8-9-19(24)20(25)13-4-2-1-3-5-13/h1-9,12,16,23H,10-11H2,(H2,22,26,27) |
| InChIKey | UKLKKWXKLGAZEE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |