C15H22F2N2O3 — CID 23291708
2-aminoacetic acid;cyclohexanamine;2,3-difluorobenzaldehyde (PubChem CID 23291708) has the molecular formula C15H22F2N2O3 and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-aminoacetic acid;cyclohexanamine;2,3-difluorobenzaldehyde.
| Compound Name | 2-aminoacetic acid;cyclohexanamine;2,3-difluorobenzaldehyde |
|---|---|
| PubChem CID | 23291708 |
| Molecular Formula | C15H22F2N2O3 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-aminoacetic acid;cyclohexanamine;2,3-difluorobenzaldehyde |
| SMILES | NC1CCCCC1.NCC(=O)O.O=Cc1cccc(F)c1F |
| InChI | InChI=1S/C7H4F2O.C6H13N.C2H5NO2/c8-6-3-1-2-5(4-10)7(6)9;7-6-4-2-1-3-5-6;3-1-2(4)5/h1-4H;6H,1-5,7H2;1,3H2,(H,4,5) |
| InChIKey | NNVMSORANCKTOS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|