C9H9F2NO3 — CID 23295601
2-aminoacetic acid;2,3-difluorobenzaldehyde (PubChem CID 23295601) has the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. Its IUPAC name is 2-aminoacetic acid;2,3-difluorobenzaldehyde.
| Compound Name | 2-aminoacetic acid;2,3-difluorobenzaldehyde |
|---|---|
| PubChem CID | 23295601 |
| Molecular Formula | C9H9F2NO3 |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-aminoacetic acid;2,3-difluorobenzaldehyde |
| SMILES | NCC(=O)O.O=Cc1cccc(F)c1F |
| InChI | InChI=1S/C7H4F2O.C2H5NO2/c8-6-3-1-2-5(4-10)7(6)9;3-1-2(4)5/h1-4H;1,3H2,(H,4,5) |
| InChIKey | VJBXOORLSGZPIU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|