C17H13BrClNO3 — CID 23292249
3-[[(E)-3-(4-bromophenyl)-2-methylprop-2-enoyl]amino]-4-chlorobenzoic acid (PubChem CID 23292249) has the molecular formula C17H13BrClNO3 and a molecular weight of 394.65 g/mol. Its IUPAC name is 3-[[(E)-3-(4-bromophenyl)-2-methylprop-2-enoyl]amino]-4-chlorobenzoic acid.
| Compound Name | 3-[[(E)-3-(4-bromophenyl)-2-methylprop-2-enoyl]amino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 23292249 |
| Molecular Formula | C17H13BrClNO3 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 3-[[(E)-3-(4-bromophenyl)-2-methylprop-2-enoyl]amino]-4-chlorobenzoic acid |
| SMILES | C/C(=C\c1ccc(Br)cc1)C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C17H13BrClNO3/c1-10(8-11-2-5-13(18)6-3-11)16(21)20-15-9-12(17(22)23)4-7-14(15)19/h2-9H,1H3,(H,20,21)(H,22,23)/b10-8+ |
| InChIKey | BKKBPJSVHDICKQ-CSKARUKUSA-N |
| XLogP | 4.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|