About 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole
2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole (PubChem CID 23295374) has the molecular formula C17H17N15
and a molecular weight of 431.43 g/mol. Its IUPAC name is 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole.
Molecular Properties
| Compound Name | 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole |
| PubChem CID | 23295374 |
| Molecular Formula | C17H17N15 |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole |
| SMILES | c1c[nH]c(C(c2ncc[nH]2)c2ncc[nH]2)n1.c1cn(C(n2ccnn2)n2ccnn2)nn1 |
| InChI | InChI=1S/C10H10N6.C7H7N9/c1-2-12-8(11-1)7(9-13-3-4-14-9)10-15-5-6-16-10;1-4-14(11-8-1)7(15-5-2-9-12-15)16-6-3-10-13-16/h1-7H,(H,11,12)(H,13,14)(H,15,16);1-7H |
| InChIKey | VSAVHPITALROKI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 178.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole?
The IUPAC name of 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole (CID 23295374) is 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole.
What is the SMILES notation for 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole?
The canonical SMILES for 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole is c1c[nH]c(C(c2ncc[nH]2)c2ncc[nH]2)n1.c1cn(C(n2ccnn2)n2ccnn2)nn1.
What is the InChIKey of 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole?
The InChIKey is VSAVHPITALROKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N6.C7H7N9/c1-2-12-8(11-1)7(9-13-3-4-14-9)10-15-5-6-16-10;1-4-14(11-8-1)7(15-5-2-9-12-15)16-6-3-10-13-16/h1-7H,(H,11,12)(H,13,14)(H,15,16);1-7H.
What are the key properties of 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole?
2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole has a molecular weight of 431.43 g/mol, XLogP of 0.05, 6 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(1H-imidazol-2-yl)methyl]-1H-imidazole;1-[bis(triazol-1-yl)methyl]triazole is sourced from PubChem (CID 23295374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).