C17H13F3N4O3 — CID 23295778
[3-[5-imidazol-1-yl-2-nitro-4-(trifluoromethyl)anilino]phenyl]methanol (PubChem CID 23295778) has the molecular formula C17H13F3N4O3 and a molecular weight of 378.31 g/mol. Its IUPAC name is [3-[5-imidazol-1-yl-2-nitro-4-(trifluoromethyl)anilino]phenyl]methanol.
| Compound Name | [3-[5-imidazol-1-yl-2-nitro-4-(trifluoromethyl)anilino]phenyl]methanol |
|---|---|
| PubChem CID | 23295778 |
| Molecular Formula | C17H13F3N4O3 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [3-[5-imidazol-1-yl-2-nitro-4-(trifluoromethyl)anilino]phenyl]methanol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(-n2ccnc2)cc1Nc1cccc(CO)c1 |
| InChI | InChI=1S/C17H13F3N4O3/c18-17(19,20)13-7-16(24(26)27)14(8-15(13)23-5-4-21-10-23)22-12-3-1-2-11(6-12)9-25/h1-8,10,22,25H,9H2 |
| InChIKey | SAJNHQUQDOXFRS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|