C16H20NO4S- — CID 23307053
4-[[(1R,5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzoate (PubChem CID 23307053) has the molecular formula C16H20NO4S- and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-[[(1R,5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzoate.
| Compound Name | 4-[[(1R,5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzoate |
|---|---|
| PubChem CID | 23307053 |
| Molecular Formula | C16H20NO4S- |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-[[(1R,5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octan-6-yl]sulfonyl]benzoate |
| SMILES | CC1(C)C[C@@H]2C[C@@H](C1)N(S(=O)(=O)c1ccc(C(=O)[O-])cc1)C2 |
| InChI | InChI=1S/C16H21NO4S/c1-16(2)8-11-7-13(9-16)17(10-11)22(20,21)14-5-3-12(4-6-14)15(18)19/h3-6,11,13H,7-10H2,1-2H3,(H,18,19)/p-1/t11-,13-/m0/s1 |
| InChIKey | VEEXLCLTNSIHPF-AAEUAGOBSA-M |
| XLogP | 1.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |