2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid

C8H8F4O4 — CID 23311503

IUPAC2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid
SMILESC=C(C(=O)O)C(CC(F)(F)C(F)F)C(=O)O
InChIInChI=1S/C8H8F4O4/c1-3(5(13)14)4(6(15)16)2-8(11,12)7(9)10/h4,7H,1-2H2,(H,13,14)(H,15,16)
InChIKeyBRMKUEGHLMEDHO-UHFFFAOYSA-N
MW244.14 g/mol
LogP1.62
Rot. Bonds6

About 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid

2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid (PubChem CID 23311503) has the molecular formula C8H8F4O4 and a molecular weight of 244.14 g/mol. Its IUPAC name is 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid.

Molecular Properties

Compound Name2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid
PubChem CID23311503
Molecular FormulaC8H8F4O4
Molecular Weight244.14 g/mol
Exact Mass244.04
IUPAC Name2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid
SMILESC=C(C(=O)O)C(CC(F)(F)C(F)F)C(=O)O
InChIInChI=1S/C8H8F4O4/c1-3(5(13)14)4(6(15)16)2-8(11,12)7(9)10/h4,7H,1-2H2,(H,13,14)(H,15,16)
InChIKeyBRMKUEGHLMEDHO-UHFFFAOYSA-N
XLogP1.62
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.14
LogP ≤ 51.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid?
The IUPAC name of 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid (CID 23311503) is 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid.
What is the SMILES notation for 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid?
The canonical SMILES for 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid is C=C(C(=O)O)C(CC(F)(F)C(F)F)C(=O)O.
What is the InChIKey of 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid?
The InChIKey is BRMKUEGHLMEDHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F4O4/c1-3(5(13)14)4(6(15)16)2-8(11,12)7(9)10/h4,7H,1-2H2,(H,13,14)(H,15,16).
What are the key properties of 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid?
2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid has a molecular weight of 244.14 g/mol, XLogP of 1.62, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid is sourced from PubChem (CID 23311503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).