C8H8F4O4 — CID 23311503
2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid (PubChem CID 23311503) has the molecular formula C8H8F4O4 and a molecular weight of 244.14 g/mol. Its IUPAC name is 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid.
| Compound Name | 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid |
|---|---|
| PubChem CID | 23311503 |
| Molecular Formula | C8H8F4O4 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-methylidene-3-(2,2,3,3-tetrafluoropropyl)butanedioic acid |
| SMILES | C=C(C(=O)O)C(CC(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C8H8F4O4/c1-3(5(13)14)4(6(15)16)2-8(11,12)7(9)10/h4,7H,1-2H2,(H,13,14)(H,15,16) |
| InChIKey | BRMKUEGHLMEDHO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|