C8H6F6O4 — CID 23311505
2-(1,1,1,2,3,3-hexafluoropropan-2-yl)-3-methylidenebutanedioic acid (PubChem CID 23311505) has the molecular formula C8H6F6O4 and a molecular weight of 280.12 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3-hexafluoropropan-2-yl)-3-methylidenebutanedioic acid.
| Compound Name | 2-(1,1,1,2,3,3-hexafluoropropan-2-yl)-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 23311505 |
| Molecular Formula | C8H6F6O4 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-(1,1,1,2,3,3-hexafluoropropan-2-yl)-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(C(=O)O)C(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F6O4/c1-2(4(15)16)3(5(17)18)7(11,6(9)10)8(12,13)14/h3,6H,1H2,(H,15,16)(H,17,18) |
| InChIKey | WXXIHLVBSHGUCG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|