C9H8N2 — CID 23321505
pyrimido[1,2-a]azepine (PubChem CID 23321505) has the molecular formula C9H8N2 and a molecular weight of 144.18 g/mol. Its IUPAC name is pyrimido[1,2-a]azepine.
| Compound Name | pyrimido[1,2-a]azepine |
|---|---|
| PubChem CID | 23321505 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | pyrimido[1,2-a]azepine |
| SMILES | C1=CC=C2N=CC=CN2C=C1 |
| InChI | InChI=1S/C9H8N2/c1-2-5-9-10-6-4-8-11(9)7-3-1/h1-8H |
| InChIKey | GBXXQIFSTDLCCT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |