C12H6F21NS — CID 23324458
2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)ethanamine (PubChem CID 23324458) has the molecular formula C12H6F21NS and a molecular weight of 595.21 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)ethanamine.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 23324458 |
| Molecular Formula | C12H6F21NS |
| Molecular Weight | 595.21 g/mol |
| Exact Mass | 594.99 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)ethanamine |
| SMILES | NCCSC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F21NS/c13-3(14,5(17,18)7(21,22)9(25,26)11(29,30)31)4(15,16)6(19,20)8(23,24)10(27,28)12(32,33)35-2-1-34/h1-2,34H2 |
| InChIKey | JUJCXPXBMXOCGR-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.21 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|